C18H27F2N — CID 82925896
[4-butyl-1-[(3,4-difluorophenyl)methyl]cyclohexyl]methanamine (PubChem CID 82925896) has the molecular formula C18H27F2N and a molecular weight of 295.42 g/mol. Its IUPAC name is [4-butyl-1-[(3,4-difluorophenyl)methyl]cyclohexyl]methanamine.
| Compound Name | [4-butyl-1-[(3,4-difluorophenyl)methyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 82925896 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | [4-butyl-1-[(3,4-difluorophenyl)methyl]cyclohexyl]methanamine |
| SMILES | CCCCC1CCC(CN)(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H27F2N/c1-2-3-4-14-7-9-18(13-21,10-8-14)12-15-5-6-16(19)17(20)11-15/h5-6,11,14H,2-4,7-10,12-13,21H2,1H3 |
| InChIKey | ZIKCSTMHGPAPIQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |