C17H25F2N — CID 82919808
1-[(3,4-difluorophenyl)methyl]-4-propylcycloheptan-1-amine (PubChem CID 82919808) has the molecular formula C17H25F2N and a molecular weight of 281.39 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-4-propylcycloheptan-1-amine.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-4-propylcycloheptan-1-amine |
|---|---|
| PubChem CID | 82919808 |
| Molecular Formula | C17H25F2N |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-4-propylcycloheptan-1-amine |
| SMILES | CCCC1CCCC(N)(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H25F2N/c1-2-4-13-5-3-9-17(20,10-8-13)12-14-6-7-15(18)16(19)11-14/h6-7,11,13H,2-5,8-10,12,20H2,1H3 |
| InChIKey | VQUGMZAQOFABRT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |