C16H24FN — CID 65082624
4-ethyl-1-[(4-fluorophenyl)methyl]cycloheptan-1-amine (PubChem CID 65082624) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is 4-ethyl-1-[(4-fluorophenyl)methyl]cycloheptan-1-amine.
| Compound Name | 4-ethyl-1-[(4-fluorophenyl)methyl]cycloheptan-1-amine |
|---|---|
| PubChem CID | 65082624 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 4-ethyl-1-[(4-fluorophenyl)methyl]cycloheptan-1-amine |
| SMILES | CCC1CCCC(N)(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H24FN/c1-2-13-4-3-10-16(18,11-9-13)12-14-5-7-15(17)8-6-14/h5-8,13H,2-4,9-12,18H2,1H3 |
| InChIKey | KUSNVJOMWOPJQZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |