About 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene
1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene (PubChem CID 140978413) has the molecular formula C20H30F2
and a molecular weight of 308.46 g/mol. Its IUPAC name is 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene |
| PubChem CID | 140978413 |
| Molecular Formula | C20H30F2 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene |
| SMILES | CCCCC1(CC)CCC(CCc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C20H30F2/c1-3-5-10-20(4-2)11-8-16(9-12-20)6-7-17-13-18(21)15-19(22)14-17/h13-16H,3-12H2,1-2H3 |
| InChIKey | BKQQGZPSLCDWCH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene?
The IUPAC name of 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene (CID 140978413) is 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene.
What is the SMILES notation for 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene?
The canonical SMILES for 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene is CCCCC1(CC)CCC(CCc2cc(F)cc(F)c2)CC1.
What is the InChIKey of 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene?
The InChIKey is BKQQGZPSLCDWCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30F2/c1-3-5-10-20(4-2)11-8-16(9-12-20)6-7-17-13-18(21)15-19(22)14-17/h13-16H,3-12H2,1-2H3.
What are the key properties of 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene?
1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene has a molecular weight of 308.46 g/mol, XLogP of 6.67, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-butyl-4-ethylcyclohexyl)ethyl]-3,5-difluorobenzene is sourced from PubChem (CID 140978413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).