C13H26 — CID 144986630
1-butyl-1,3-diethylcyclopentane (PubChem CID 144986630) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is 1-butyl-1,3-diethylcyclopentane.
| Compound Name | 1-butyl-1,3-diethylcyclopentane |
|---|---|
| PubChem CID | 144986630 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 1-butyl-1,3-diethylcyclopentane |
| SMILES | CCCCC1(CC)CCC(CC)C1 |
| InChI | InChI=1S/C13H26/c1-4-7-9-13(6-3)10-8-12(5-2)11-13/h12H,4-11H2,1-3H3 |
| InChIKey | IMAWBNRBGIFKGU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |