C16H18F3N — CID 65378094
3-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carbonitrile (PubChem CID 65378094) has the molecular formula C16H18F3N and a molecular weight of 281.32 g/mol. Its IUPAC name is 3-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carbonitrile.
| Compound Name | 3-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 65378094 |
| Molecular Formula | C16H18F3N |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carbonitrile |
| SMILES | CC1CCCC(C#N)(Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H18F3N/c1-12-4-3-7-15(9-12,11-20)10-13-5-2-6-14(8-13)16(17,18)19/h2,5-6,8,12H,3-4,7,9-10H2,1H3 |
| InChIKey | JOJUUQUUUHRABL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |