C14H16N2O2 — CID 65403077
3-methyl-1-[(3-nitrophenyl)methyl]cyclopentane-1-carbonitrile (PubChem CID 65403077) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-methyl-1-[(3-nitrophenyl)methyl]cyclopentane-1-carbonitrile.
| Compound Name | 3-methyl-1-[(3-nitrophenyl)methyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 65403077 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-methyl-1-[(3-nitrophenyl)methyl]cyclopentane-1-carbonitrile |
| SMILES | CC1CCC(C#N)(Cc2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C14H16N2O2/c1-11-5-6-14(8-11,10-15)9-12-3-2-4-13(7-12)16(17)18/h2-4,7,11H,5-6,8-9H2,1H3 |
| InChIKey | ROOHMHLPACBNTQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|