C19H27N — CID 65402458
4-tert-butyl-1-[(3-methylphenyl)methyl]cyclohexane-1-carbonitrile (PubChem CID 65402458) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 4-tert-butyl-1-[(3-methylphenyl)methyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-tert-butyl-1-[(3-methylphenyl)methyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 65402458 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 4-tert-butyl-1-[(3-methylphenyl)methyl]cyclohexane-1-carbonitrile |
| SMILES | Cc1cccc(CC2(C#N)CCC(C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H27N/c1-15-6-5-7-16(12-15)13-19(14-20)10-8-17(9-11-19)18(2,3)4/h5-7,12,17H,8-11,13H2,1-4H3 |
| InChIKey | FIIQCOYJOVJJPK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |