C18H28FN — CID 65089483
4-tert-butyl-1-[(3-fluorophenyl)methyl]cycloheptan-1-amine (PubChem CID 65089483) has the molecular formula C18H28FN and a molecular weight of 277.43 g/mol. Its IUPAC name is 4-tert-butyl-1-[(3-fluorophenyl)methyl]cycloheptan-1-amine.
| Compound Name | 4-tert-butyl-1-[(3-fluorophenyl)methyl]cycloheptan-1-amine |
|---|---|
| PubChem CID | 65089483 |
| Molecular Formula | C18H28FN |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 4-tert-butyl-1-[(3-fluorophenyl)methyl]cycloheptan-1-amine |
| SMILES | CC(C)(C)C1CCCC(N)(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H28FN/c1-17(2,3)15-7-5-10-18(20,11-9-15)13-14-6-4-8-16(19)12-14/h4,6,8,12,15H,5,7,9-11,13,20H2,1-3H3 |
| InChIKey | RYOYWGPVTJQALH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |