C20H33N — CID 65090155
4-tert-butyl-1-(3-phenylpropyl)cycloheptan-1-amine (PubChem CID 65090155) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 4-tert-butyl-1-(3-phenylpropyl)cycloheptan-1-amine.
| Compound Name | 4-tert-butyl-1-(3-phenylpropyl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 65090155 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 4-tert-butyl-1-(3-phenylpropyl)cycloheptan-1-amine |
| SMILES | CC(C)(C)C1CCCC(N)(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H33N/c1-19(2,3)18-12-8-15-20(21,16-13-18)14-7-11-17-9-5-4-6-10-17/h4-6,9-10,18H,7-8,11-16,21H2,1-3H3 |
| InChIKey | LKIAOQVKLAHIMU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |