C17H35N — CID 114209791
4-tert-butyl-1-(4,4-dimethylpentyl)cyclohexan-1-amine (PubChem CID 114209791) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is 4-tert-butyl-1-(4,4-dimethylpentyl)cyclohexan-1-amine.
| Compound Name | 4-tert-butyl-1-(4,4-dimethylpentyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 114209791 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | 4-tert-butyl-1-(4,4-dimethylpentyl)cyclohexan-1-amine |
| SMILES | CC(C)(C)CCCC1(N)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H35N/c1-15(2,3)10-7-11-17(18)12-8-14(9-13-17)16(4,5)6/h14H,7-13,18H2,1-6H3 |
| InChIKey | NMFQQYDOBJGIMR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |