C15H31N — CID 63411887
1-(3,3-dimethylbutyl)-4-propan-2-ylcyclohexan-1-amine (PubChem CID 63411887) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-4-propan-2-ylcyclohexan-1-amine.
| Compound Name | 1-(3,3-dimethylbutyl)-4-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63411887 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-4-propan-2-ylcyclohexan-1-amine |
| SMILES | CC(C)C1CCC(N)(CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H31N/c1-12(2)13-6-8-15(16,9-7-13)11-10-14(3,4)5/h12-13H,6-11,16H2,1-5H3 |
| InChIKey | UDOWTUCTCSZWQU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |