C20H32O — CID 65151218
4-tert-butyl-1-(3-phenylpropyl)cycloheptan-1-ol (PubChem CID 65151218) has the molecular formula C20H32O and a molecular weight of 288.47 g/mol. Its IUPAC name is 4-tert-butyl-1-(3-phenylpropyl)cycloheptan-1-ol.
| Compound Name | 4-tert-butyl-1-(3-phenylpropyl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 65151218 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 4-tert-butyl-1-(3-phenylpropyl)cycloheptan-1-ol |
| SMILES | CC(C)(C)C1CCCC(O)(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H32O/c1-19(2,3)18-12-8-15-20(21,16-13-18)14-7-11-17-9-5-4-6-10-17/h4-6,9-10,18,21H,7-8,11-16H2,1-3H3 |
| InChIKey | UHFYSKLIYCQRPD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |