C18H26Cl2O — CID 65151667
4-tert-butyl-1-[(2,6-dichlorophenyl)methyl]cycloheptan-1-ol (PubChem CID 65151667) has the molecular formula C18H26Cl2O and a molecular weight of 329.31 g/mol. Its IUPAC name is 4-tert-butyl-1-[(2,6-dichlorophenyl)methyl]cycloheptan-1-ol.
| Compound Name | 4-tert-butyl-1-[(2,6-dichlorophenyl)methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 65151667 |
| Molecular Formula | C18H26Cl2O |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4-tert-butyl-1-[(2,6-dichlorophenyl)methyl]cycloheptan-1-ol |
| SMILES | CC(C)(C)C1CCCC(O)(Cc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C18H26Cl2O/c1-17(2,3)13-6-5-10-18(21,11-9-13)12-14-15(19)7-4-8-16(14)20/h4,7-8,13,21H,5-6,9-12H2,1-3H3 |
| InChIKey | HLXNZZUOUQCELG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |