C18H26ClFO — CID 114852298
4-tert-butyl-1-[(4-chloro-2-fluorophenyl)methyl]cycloheptan-1-ol (PubChem CID 114852298) has the molecular formula C18H26ClFO and a molecular weight of 312.86 g/mol. Its IUPAC name is 4-tert-butyl-1-[(4-chloro-2-fluorophenyl)methyl]cycloheptan-1-ol.
| Compound Name | 4-tert-butyl-1-[(4-chloro-2-fluorophenyl)methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 114852298 |
| Molecular Formula | C18H26ClFO |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-tert-butyl-1-[(4-chloro-2-fluorophenyl)methyl]cycloheptan-1-ol |
| SMILES | CC(C)(C)C1CCCC(O)(Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C18H26ClFO/c1-17(2,3)14-5-4-9-18(21,10-8-14)12-13-6-7-15(19)11-16(13)20/h6-7,11,14,21H,4-5,8-10,12H2,1-3H3 |
| InChIKey | NZKLMLKDBVHFQR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |