C17H24Cl2O — CID 65316707
4-tert-butyl-1-[(2,5-dichlorophenyl)methyl]cyclohexan-1-ol (PubChem CID 65316707) has the molecular formula C17H24Cl2O and a molecular weight of 315.28 g/mol. Its IUPAC name is 4-tert-butyl-1-[(2,5-dichlorophenyl)methyl]cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-1-[(2,5-dichlorophenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65316707 |
| Molecular Formula | C17H24Cl2O |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 4-tert-butyl-1-[(2,5-dichlorophenyl)methyl]cyclohexan-1-ol |
| SMILES | CC(C)(C)C1CCC(O)(Cc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H24Cl2O/c1-16(2,3)13-6-8-17(20,9-7-13)11-12-10-14(18)4-5-15(12)19/h4-5,10,13,20H,6-9,11H2,1-3H3 |
| InChIKey | ZIUFCERJFNFKGL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |