C20H32O — CID 65147785
4-tert-butyl-1-[(4-propan-2-ylphenyl)methyl]cyclohexan-1-ol (PubChem CID 65147785) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 4-tert-butyl-1-[(4-propan-2-ylphenyl)methyl]cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-1-[(4-propan-2-ylphenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65147785 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 4-tert-butyl-1-[(4-propan-2-ylphenyl)methyl]cyclohexan-1-ol |
| SMILES | CC(C)c1ccc(CC2(O)CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H32O/c1-15(2)17-8-6-16(7-9-17)14-20(21)12-10-18(11-13-20)19(3,4)5/h6-9,15,18,21H,10-14H2,1-5H3 |
| InChIKey | LMGWAOQUZXRCLR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |