C19H30O — CID 65147469
1-[(4-propan-2-ylphenyl)methyl]-4-propylcyclohexan-1-ol (PubChem CID 65147469) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-[(4-propan-2-ylphenyl)methyl]-4-propylcyclohexan-1-ol.
| Compound Name | 1-[(4-propan-2-ylphenyl)methyl]-4-propylcyclohexan-1-ol |
|---|---|
| PubChem CID | 65147469 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 1-[(4-propan-2-ylphenyl)methyl]-4-propylcyclohexan-1-ol |
| SMILES | CCCC1CCC(O)(Cc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H30O/c1-4-5-16-10-12-19(20,13-11-16)14-17-6-8-18(9-7-17)15(2)3/h6-9,15-16,20H,4-5,10-14H2,1-3H3 |
| InChIKey | PITXUWJBZAOHFI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |