C17H23F3O — CID 65153807
1-[(4-propan-2-ylphenyl)methyl]-4-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 65153807) has the molecular formula C17H23F3O and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-[(4-propan-2-ylphenyl)methyl]-4-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-[(4-propan-2-ylphenyl)methyl]-4-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 65153807 |
| Molecular Formula | C17H23F3O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-[(4-propan-2-ylphenyl)methyl]-4-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | CC(C)c1ccc(CC2(O)CCC(C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C17H23F3O/c1-12(2)14-5-3-13(4-6-14)11-16(21)9-7-15(8-10-16)17(18,19)20/h3-6,12,15,21H,7-11H2,1-2H3 |
| InChIKey | WPXMHGFFUYGNSX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |