C12H14F2O — CID 117302989
1-[[4-(1,1-difluoroethyl)phenyl]methyl]cyclopropan-1-ol (PubChem CID 117302989) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-[[4-(1,1-difluoroethyl)phenyl]methyl]cyclopropan-1-ol.
| Compound Name | 1-[[4-(1,1-difluoroethyl)phenyl]methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 117302989 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-[[4-(1,1-difluoroethyl)phenyl]methyl]cyclopropan-1-ol |
| SMILES | CC(F)(F)c1ccc(CC2(O)CC2)cc1 |
| InChI | InChI=1S/C12H14F2O/c1-11(13,14)10-4-2-9(3-5-10)8-12(15)6-7-12/h2-5,15H,6-8H2,1H3 |
| InChIKey | RHXZGUOILUTAFQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |