C18H28O2 — CID 106874139
1-[(4-tert-butylphenyl)methyl]-3-methoxycyclohexan-1-ol (PubChem CID 106874139) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3-methoxycyclohexan-1-ol.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3-methoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 106874139 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3-methoxycyclohexan-1-ol |
| SMILES | COC1CCCC(O)(Cc2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C18H28O2/c1-17(2,3)15-9-7-14(8-10-15)12-18(19)11-5-6-16(13-18)20-4/h7-10,16,19H,5-6,11-13H2,1-4H3 |
| InChIKey | QOQGGHOGBUMHIM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |