C14H18ClFO2 — CID 106873962
1-[(2-chloro-4-fluorophenyl)methyl]-3-methoxycyclohexan-1-ol (PubChem CID 106873962) has the molecular formula C14H18ClFO2 and a molecular weight of 272.75 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-3-methoxycyclohexan-1-ol.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-3-methoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 106873962 |
| Molecular Formula | C14H18ClFO2 |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-3-methoxycyclohexan-1-ol |
| SMILES | COC1CCCC(O)(Cc2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C14H18ClFO2/c1-18-12-3-2-6-14(17,9-12)8-10-4-5-11(16)7-13(10)15/h4-5,7,12,17H,2-3,6,8-9H2,1H3 |
| InChIKey | XEGHLYWETPRMOD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |