C14H17ClFNO — CID 65145900
3-[(2-chloro-4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 65145900) has the molecular formula C14H17ClFNO and a molecular weight of 269.75 g/mol. Its IUPAC name is 3-[(2-chloro-4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[(2-chloro-4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 65145900 |
| Molecular Formula | C14H17ClFNO |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 3-[(2-chloro-4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(Cc2ccc(F)cc2Cl)CC2CCC(C1)N2 |
| InChI | InChI=1S/C14H17ClFNO/c15-13-5-10(16)2-1-9(13)6-14(18)7-11-3-4-12(8-14)17-11/h1-2,5,11-12,17-18H,3-4,6-8H2 |
| InChIKey | PQNYDBQVNAVEFN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |