C16H14ClFO — CID 65147155
2-[(2-chloro-4-fluorophenyl)methyl]-1,3-dihydroinden-2-ol (PubChem CID 65147155) has the molecular formula C16H14ClFO and a molecular weight of 276.74 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methyl]-1,3-dihydroinden-2-ol.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methyl]-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 65147155 |
| Molecular Formula | C16H14ClFO |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methyl]-1,3-dihydroinden-2-ol |
| SMILES | OC1(Cc2ccc(F)cc2Cl)Cc2ccccc2C1 |
| InChI | InChI=1S/C16H14ClFO/c17-15-7-14(18)6-5-13(15)10-16(19)8-11-3-1-2-4-12(11)9-16/h1-7,19H,8-10H2 |
| InChIKey | FRJKEGYLZBDAJZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |