C18H17BrClF — CID 66049640
4-(bromomethyl)-4-[(2-chloro-4-fluorophenyl)methyl]-2,3-dihydro-1H-naphthalene (PubChem CID 66049640) has the molecular formula C18H17BrClF and a molecular weight of 367.69 g/mol. Its IUPAC name is 4-(bromomethyl)-4-[(2-chloro-4-fluorophenyl)methyl]-2,3-dihydro-1H-naphthalene.
| Compound Name | 4-(bromomethyl)-4-[(2-chloro-4-fluorophenyl)methyl]-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 66049640 |
| Molecular Formula | C18H17BrClF |
| Molecular Weight | 367.69 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 4-(bromomethyl)-4-[(2-chloro-4-fluorophenyl)methyl]-2,3-dihydro-1H-naphthalene |
| SMILES | Fc1ccc(CC2(CBr)CCCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C18H17BrClF/c19-12-18(11-14-7-8-15(21)10-17(14)20)9-3-5-13-4-1-2-6-16(13)18/h1-2,4,6-8,10H,3,5,9,11-12H2 |
| InChIKey | OQCNRSDUJFKQGX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.69 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|