About 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene
4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene (PubChem CID 66049410) has the molecular formula C18H17BrCl2
and a molecular weight of 384.14 g/mol. Its IUPAC name is 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene |
| PubChem CID | 66049410 |
| Molecular Formula | C18H17BrCl2 |
| Molecular Weight | 384.14 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene |
| SMILES | Clc1ccc(CC2(CBr)CCCc3ccccc32)cc1Cl |
| InChI | InChI=1S/C18H17BrCl2/c19-12-18(11-13-7-8-16(20)17(21)10-13)9-3-5-14-4-1-2-6-15(14)18/h1-2,4,6-8,10H,3,5,9,11-12H2 |
| InChIKey | WZARKFKVNZNVCO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.14 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene?
The IUPAC name of 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene (CID 66049410) is 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene?
The canonical SMILES for 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene is Clc1ccc(CC2(CBr)CCCc3ccccc32)cc1Cl.
What is the InChIKey of 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene?
The InChIKey is WZARKFKVNZNVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrCl2/c19-12-18(11-13-7-8-16(20)17(21)10-13)9-3-5-14-4-1-2-6-15(14)18/h1-2,4,6-8,10H,3,5,9,11-12H2.
What are the key properties of 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene?
4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene has a molecular weight of 384.14 g/mol, XLogP of 6.21, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-4-[(3,4-dichlorophenyl)methyl]-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 66049410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).