C16H14ClFO — CID 105393720
1-(2-chloro-5-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 105393720) has the molecular formula C16H14ClFO and a molecular weight of 276.74 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 105393720 |
| Molecular Formula | C16H14ClFO |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | OC1(c2cc(F)ccc2Cl)CCCc2ccccc21 |
| InChI | InChI=1S/C16H14ClFO/c17-15-8-7-12(18)10-14(15)16(19)9-3-5-11-4-1-2-6-13(11)16/h1-2,4,6-8,10,19H,3,5,9H2 |
| InChIKey | ZPMUFGOEOKXCPF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |