C14H12ClFO2 — CID 105393986
4-(2-chloro-5-fluorophenyl)-6,7-dihydro-5H-1-benzofuran-4-ol (PubChem CID 105393986) has the molecular formula C14H12ClFO2 and a molecular weight of 266.70 g/mol. Its IUPAC name is 4-(2-chloro-5-fluorophenyl)-6,7-dihydro-5H-1-benzofuran-4-ol.
| Compound Name | 4-(2-chloro-5-fluorophenyl)-6,7-dihydro-5H-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 105393986 |
| Molecular Formula | C14H12ClFO2 |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 4-(2-chloro-5-fluorophenyl)-6,7-dihydro-5H-1-benzofuran-4-ol |
| SMILES | OC1(c2cc(F)ccc2Cl)CCCc2occc21 |
| InChI | InChI=1S/C14H12ClFO2/c15-12-4-3-9(16)8-11(12)14(17)6-1-2-13-10(14)5-7-18-13/h3-5,7-8,17H,1-2,6H2 |
| InChIKey | XYWWVFKLDBFOAS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |