C15H22O2 — CID 115466959
4-(cyclohexylmethyl)-6,7-dihydro-5H-1-benzofuran-4-ol (PubChem CID 115466959) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-6,7-dihydro-5H-1-benzofuran-4-ol.
| Compound Name | 4-(cyclohexylmethyl)-6,7-dihydro-5H-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 115466959 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 4-(cyclohexylmethyl)-6,7-dihydro-5H-1-benzofuran-4-ol |
| SMILES | OC1(CC2CCCCC2)CCCc2occc21 |
| InChI | InChI=1S/C15H22O2/c16-15(11-12-5-2-1-3-6-12)9-4-7-14-13(15)8-10-17-14/h8,10,12,16H,1-7,9,11H2 |
| InChIKey | GIJNCUSUCLAWHM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |