About 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol
4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol (PubChem CID 115467108) has the molecular formula C12H12O2S
and a molecular weight of 220.29 g/mol. Its IUPAC name is 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol.
Molecular Properties
| Compound Name | 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol |
| PubChem CID | 115467108 |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol |
| SMILES | OC1(c2ccsc2)CCCc2occc21 |
| InChI | InChI=1S/C12H12O2S/c13-12(9-4-7-15-8-9)5-1-2-11-10(12)3-6-14-11/h3-4,6-8,13H,1-2,5H2 |
| InChIKey | CSIWGGBKCXOKPB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol?
The IUPAC name of 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol (CID 115467108) is 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol.
What is the SMILES notation for 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol?
The canonical SMILES for 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol is OC1(c2ccsc2)CCCc2occc21.
What is the InChIKey of 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol?
The InChIKey is CSIWGGBKCXOKPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2S/c13-12(9-4-7-15-8-9)5-1-2-11-10(12)3-6-14-11/h3-4,6-8,13H,1-2,5H2.
What are the key properties of 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol?
4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol has a molecular weight of 220.29 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol is sourced from PubChem (CID 115467108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).