C12H12O2S — CID 115467108
4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol (PubChem CID 115467108) has the molecular formula C12H12O2S and a molecular weight of 220.29 g/mol. Its IUPAC name is 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol.
| Compound Name | 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 115467108 |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 4-thiophen-3-yl-6,7-dihydro-5H-1-benzofuran-4-ol |
| SMILES | OC1(c2ccsc2)CCCc2occc21 |
| InChI | InChI=1S/C12H12O2S/c13-12(9-4-7-15-8-9)5-1-2-11-10(12)3-6-14-11/h3-4,6-8,13H,1-2,5H2 |
| InChIKey | CSIWGGBKCXOKPB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |