C15H16O3 — CID 115466952
4-(4-methoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol (PubChem CID 115466952) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol.
| Compound Name | 4-(4-methoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 115466952 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 4-(4-methoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol |
| SMILES | COc1ccc(C2(O)CCCc3occc32)cc1 |
| InChI | InChI=1S/C15H16O3/c1-17-12-6-4-11(5-7-12)15(16)9-2-3-14-13(15)8-10-18-14/h4-8,10,16H,2-3,9H2,1H3 |
| InChIKey | MUJMJOKSQIUILE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |