About 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol
4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol (PubChem CID 115467084) has the molecular formula C16H18O4
and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol.
Molecular Properties
| Compound Name | 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol |
| PubChem CID | 115467084 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol |
| SMILES | COc1cc(OC)cc(C2(O)CCCc3occc32)c1 |
| InChI | InChI=1S/C16H18O4/c1-18-12-8-11(9-13(10-12)19-2)16(17)6-3-4-15-14(16)5-7-20-15/h5,7-10,17H,3-4,6H2,1-2H3 |
| InChIKey | QSKAIBMLJQCKNL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol?
The IUPAC name of 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol (CID 115467084) is 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol.
What is the SMILES notation for 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol?
The canonical SMILES for 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol is COc1cc(OC)cc(C2(O)CCCc3occc32)c1.
What is the InChIKey of 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol?
The InChIKey is QSKAIBMLJQCKNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O4/c1-18-12-8-11(9-13(10-12)19-2)16(17)6-3-4-15-14(16)5-7-20-15/h5,7-10,17H,3-4,6H2,1-2H3.
What are the key properties of 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol?
4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol has a molecular weight of 274.32 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethoxyphenyl)-6,7-dihydro-5H-1-benzofuran-4-ol is sourced from PubChem (CID 115467084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).