C17H18O3 — CID 79374921
6-methoxy-1-(3-methoxyphenyl)-2,3-dihydroinden-1-ol (PubChem CID 79374921) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 6-methoxy-1-(3-methoxyphenyl)-2,3-dihydroinden-1-ol.
| Compound Name | 6-methoxy-1-(3-methoxyphenyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 79374921 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 6-methoxy-1-(3-methoxyphenyl)-2,3-dihydroinden-1-ol |
| SMILES | COc1cccc(C2(O)CCc3ccc(OC)cc32)c1 |
| InChI | InChI=1S/C17H18O3/c1-19-14-5-3-4-13(10-14)17(18)9-8-12-6-7-15(20-2)11-16(12)17/h3-7,10-11,18H,8-9H2,1-2H3 |
| InChIKey | DJJDIPYEVGVWKO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |