C12H12O2 — CID 79374777
1-ethynyl-6-methoxy-2,3-dihydroinden-1-ol (PubChem CID 79374777) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 1-ethynyl-6-methoxy-2,3-dihydroinden-1-ol.
| Compound Name | 1-ethynyl-6-methoxy-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 79374777 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1-ethynyl-6-methoxy-2,3-dihydroinden-1-ol |
| SMILES | C#CC1(O)CCc2ccc(OC)cc21 |
| InChI | InChI=1S/C12H12O2/c1-3-12(13)7-6-9-4-5-10(14-2)8-11(9)12/h1,4-5,8,13H,6-7H2,2H3 |
| InChIKey | YNYSUKKVBSQTCO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|