C12H15NO — CID 124511846
(3S)-5-methoxyspiro[1,2-dihydroindene-3,2'-azetidine] (PubChem CID 124511846) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (3S)-5-methoxyspiro[1,2-dihydroindene-3,2'-azetidine].
| Compound Name | (3S)-5-methoxyspiro[1,2-dihydroindene-3,2'-azetidine] |
|---|---|
| PubChem CID | 124511846 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (3S)-5-methoxyspiro[1,2-dihydroindene-3,2'-azetidine] |
| SMILES | COc1ccc2c(c1)[C@@]1(CCN1)CC2 |
| InChI | InChI=1S/C12H15NO/c1-14-10-3-2-9-4-5-12(6-7-13-12)11(9)8-10/h2-3,8,13H,4-7H2,1H3/t12-/m0/s1 |
| InChIKey | VBHQNNKWKCQWAX-LBPRGKRZSA-N |
| XLogP | 1.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |