C12H18O2 — CID 115466987
4-butan-2-yl-6,7-dihydro-5H-1-benzofuran-4-ol (PubChem CID 115466987) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-butan-2-yl-6,7-dihydro-5H-1-benzofuran-4-ol.
| Compound Name | 4-butan-2-yl-6,7-dihydro-5H-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 115466987 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-butan-2-yl-6,7-dihydro-5H-1-benzofuran-4-ol |
| SMILES | CCC(C)C1(O)CCCc2occc21 |
| InChI | InChI=1S/C12H18O2/c1-3-9(2)12(13)7-4-5-11-10(12)6-8-14-11/h6,8-9,13H,3-5,7H2,1-2H3 |
| InChIKey | UPQMIEKTERQAOE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |