C14H16O2S — CID 113315334
4-(2-thiophen-3-ylethyl)-6,7-dihydro-5H-1-benzofuran-4-ol (PubChem CID 113315334) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-(2-thiophen-3-ylethyl)-6,7-dihydro-5H-1-benzofuran-4-ol.
| Compound Name | 4-(2-thiophen-3-ylethyl)-6,7-dihydro-5H-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 113315334 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-(2-thiophen-3-ylethyl)-6,7-dihydro-5H-1-benzofuran-4-ol |
| SMILES | OC1(CCc2ccsc2)CCCc2occc21 |
| InChI | InChI=1S/C14H16O2S/c15-14(7-3-11-5-9-17-10-11)6-1-2-13-12(14)4-8-16-13/h4-5,8-10,15H,1-3,6-7H2 |
| InChIKey | RAMLNQNBNJCQKL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |