C13H20O2S — CID 65149154
2,2-dimethyl-4-(2-thiophen-3-ylethyl)oxan-4-ol (PubChem CID 65149154) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-thiophen-3-ylethyl)oxan-4-ol.
| Compound Name | 2,2-dimethyl-4-(2-thiophen-3-ylethyl)oxan-4-ol |
|---|---|
| PubChem CID | 65149154 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2,2-dimethyl-4-(2-thiophen-3-ylethyl)oxan-4-ol |
| SMILES | CC1(C)CC(O)(CCc2ccsc2)CCO1 |
| InChI | InChI=1S/C13H20O2S/c1-12(2)10-13(14,6-7-15-12)5-3-11-4-8-16-9-11/h4,8-9,14H,3,5-7,10H2,1-2H3 |
| InChIKey | KYXSUPYAUHSAQV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |