C12H17BrS — CID 116540728
3-[2-(3-bromo-1-methylcyclopentyl)ethyl]thiophene (PubChem CID 116540728) has the molecular formula C12H17BrS and a molecular weight of 273.24 g/mol. Its IUPAC name is 3-[2-(3-bromo-1-methylcyclopentyl)ethyl]thiophene.
| Compound Name | 3-[2-(3-bromo-1-methylcyclopentyl)ethyl]thiophene |
|---|---|
| PubChem CID | 116540728 |
| Molecular Formula | C12H17BrS |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 3-[2-(3-bromo-1-methylcyclopentyl)ethyl]thiophene |
| SMILES | CC1(CCc2ccsc2)CCC(Br)C1 |
| InChI | InChI=1S/C12H17BrS/c1-12(6-3-11(13)8-12)5-2-10-4-7-14-9-10/h4,7,9,11H,2-3,5-6,8H2,1H3 |
| InChIKey | OTEZAMOLSPGNKG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|