C13H19NS — CID 65020335
2-(2-thiophen-3-ylethyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 65020335) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is 2-(2-thiophen-3-ylethyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | 2-(2-thiophen-3-ylethyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 65020335 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-(2-thiophen-3-ylethyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | NC1(CCc2ccsc2)CC2CCC1C2 |
| InChI | InChI=1S/C13H19NS/c14-13(5-3-10-4-6-15-9-10)8-11-1-2-12(13)7-11/h4,6,9,11-12H,1-3,5,7-8,14H2 |
| InChIKey | CESXJAWEQMJCRR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |