C14H18ClN — CID 65020172
2-[(3-chlorophenyl)methyl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 65020172) has the molecular formula C14H18ClN and a molecular weight of 235.76 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | 2-[(3-chlorophenyl)methyl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 65020172 |
| Molecular Formula | C14H18ClN |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | NC1(Cc2cccc(Cl)c2)CC2CCC1C2 |
| InChI | InChI=1S/C14H18ClN/c15-13-3-1-2-10(7-13)8-14(16)9-11-4-5-12(14)6-11/h1-3,7,11-12H,4-6,8-9,16H2 |
| InChIKey | DJFUYLNNGHMWJE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |