C14H16BrF2N — CID 106273551
2-[(3-bromo-2,6-difluorophenyl)methyl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 106273551) has the molecular formula C14H16BrF2N and a molecular weight of 316.19 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 106273551 |
| Molecular Formula | C14H16BrF2N |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | NC1(Cc2c(F)ccc(Br)c2F)CC2CCC1C2 |
| InChI | InChI=1S/C14H16BrF2N/c15-11-3-4-12(16)10(13(11)17)7-14(18)6-8-1-2-9(14)5-8/h3-4,8-9H,1-2,5-7,18H2 |
| InChIKey | CSSULVJOEXCRPN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|