C14H17ClN2O2 — CID 65020282
2-[(4-chloro-2-nitrophenyl)methyl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 65020282) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 2-[(4-chloro-2-nitrophenyl)methyl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | 2-[(4-chloro-2-nitrophenyl)methyl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 65020282 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-[(4-chloro-2-nitrophenyl)methyl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | NC1(Cc2ccc(Cl)cc2[N+](=O)[O-])CC2CCC1C2 |
| InChI | InChI=1S/C14H17ClN2O2/c15-12-4-2-10(13(6-12)17(18)19)8-14(16)7-9-1-3-11(14)5-9/h2,4,6,9,11H,1,3,5,7-8,16H2 |
| InChIKey | XULLULPUZIKYER-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|