C16H19ClN2O2 — CID 65402670
1-[(4-chloro-2-nitrophenyl)methyl]-3-ethylcyclohexane-1-carbonitrile (PubChem CID 65402670) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 1-[(4-chloro-2-nitrophenyl)methyl]-3-ethylcyclohexane-1-carbonitrile.
| Compound Name | 1-[(4-chloro-2-nitrophenyl)methyl]-3-ethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 65402670 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-[(4-chloro-2-nitrophenyl)methyl]-3-ethylcyclohexane-1-carbonitrile |
| SMILES | CCC1CCCC(C#N)(Cc2ccc(Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-2-12-4-3-7-16(9-12,11-18)10-13-5-6-14(17)8-15(13)19(20)21/h5-6,8,12H,2-4,7,9-10H2,1H3 |
| InChIKey | GKNKVRZJHFUZCR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|