C17H22FN — CID 114349722
3-ethyl-1-[(4-fluoro-2-methylphenyl)methyl]cyclohexane-1-carbonitrile (PubChem CID 114349722) has the molecular formula C17H22FN and a molecular weight of 259.37 g/mol. Its IUPAC name is 3-ethyl-1-[(4-fluoro-2-methylphenyl)methyl]cyclohexane-1-carbonitrile.
| Compound Name | 3-ethyl-1-[(4-fluoro-2-methylphenyl)methyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 114349722 |
| Molecular Formula | C17H22FN |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-ethyl-1-[(4-fluoro-2-methylphenyl)methyl]cyclohexane-1-carbonitrile |
| SMILES | CCC1CCCC(C#N)(Cc2ccc(F)cc2C)C1 |
| InChI | InChI=1S/C17H22FN/c1-3-14-5-4-8-17(10-14,12-19)11-15-6-7-16(18)9-13(15)2/h6-7,9,14H,3-5,8,10-11H2,1-2H3 |
| InChIKey | VBJCJXAXGZYOQN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |