C16H20IN — CID 65491972
3-ethyl-1-[(4-iodophenyl)methyl]cyclohexane-1-carbonitrile (PubChem CID 65491972) has the molecular formula C16H20IN and a molecular weight of 353.25 g/mol. Its IUPAC name is 3-ethyl-1-[(4-iodophenyl)methyl]cyclohexane-1-carbonitrile.
| Compound Name | 3-ethyl-1-[(4-iodophenyl)methyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 65491972 |
| Molecular Formula | C16H20IN |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 3-ethyl-1-[(4-iodophenyl)methyl]cyclohexane-1-carbonitrile |
| SMILES | CCC1CCCC(C#N)(Cc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C16H20IN/c1-2-13-4-3-9-16(10-13,12-18)11-14-5-7-15(17)8-6-14/h5-8,13H,2-4,9-11H2,1H3 |
| InChIKey | VIYCBTTWYXSDDG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|