C17H22BrNO — CID 65403270
1-[2-(4-bromophenoxy)ethyl]-3-ethylcyclohexane-1-carbonitrile (PubChem CID 65403270) has the molecular formula C17H22BrNO and a molecular weight of 336.27 g/mol. Its IUPAC name is 1-[2-(4-bromophenoxy)ethyl]-3-ethylcyclohexane-1-carbonitrile.
| Compound Name | 1-[2-(4-bromophenoxy)ethyl]-3-ethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 65403270 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-[2-(4-bromophenoxy)ethyl]-3-ethylcyclohexane-1-carbonitrile |
| SMILES | CCC1CCCC(C#N)(CCOc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H22BrNO/c1-2-14-4-3-9-17(12-14,13-19)10-11-20-16-7-5-15(18)6-8-16/h5-8,14H,2-4,9-12H2,1H3 |
| InChIKey | VJTHLNZANRKBBP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |