C28H37NO — CID 19800756
1-[2-[4-(4-hexoxyphenyl)phenyl]ethyl]-3-methylcyclohexane-1-carbonitrile (PubChem CID 19800756) has the molecular formula C28H37NO and a molecular weight of 403.61 g/mol. Its IUPAC name is 1-[2-[4-(4-hexoxyphenyl)phenyl]ethyl]-3-methylcyclohexane-1-carbonitrile.
| Compound Name | 1-[2-[4-(4-hexoxyphenyl)phenyl]ethyl]-3-methylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 19800756 |
| Molecular Formula | C28H37NO |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 1-[2-[4-(4-hexoxyphenyl)phenyl]ethyl]-3-methylcyclohexane-1-carbonitrile |
| SMILES | CCCCCCOc1ccc(-c2ccc(CCC3(C#N)CCCC(C)C3)cc2)cc1 |
| InChI | InChI=1S/C28H37NO/c1-3-4-5-6-20-30-27-15-13-26(14-16-27)25-11-9-24(10-12-25)17-19-28(22-29)18-7-8-23(2)21-28/h9-16,23H,3-8,17-21H2,1-2H3 |
| InChIKey | DWGQDRCHUXYZTJ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|