C34H45NO2 — CID 67898141
9-[1-cyano-3-[4-(4-propylphenyl)phenyl]cyclohexyl]nonyl prop-2-enoate (PubChem CID 67898141) has the molecular formula C34H45NO2 and a molecular weight of 499.74 g/mol. Its IUPAC name is 9-[1-cyano-3-[4-(4-propylphenyl)phenyl]cyclohexyl]nonyl prop-2-enoate.
| Compound Name | 9-[1-cyano-3-[4-(4-propylphenyl)phenyl]cyclohexyl]nonyl prop-2-enoate |
|---|---|
| PubChem CID | 67898141 |
| Molecular Formula | C34H45NO2 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.35 |
| IUPAC Name | 9-[1-cyano-3-[4-(4-propylphenyl)phenyl]cyclohexyl]nonyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCCC1(C#N)CCCC(c2ccc(-c3ccc(CCC)cc3)cc2)C1 |
| InChI | InChI=1S/C34H45NO2/c1-3-13-28-15-17-29(18-16-28)30-19-21-31(22-20-30)32-14-12-24-34(26-32,27-35)23-10-8-6-5-7-9-11-25-37-33(36)4-2/h4,15-22,32H,2-3,5-14,23-26H2,1H3 |
| InChIKey | VXHINBFQSMTVLP-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|