C32H45NO2 — CID 67898541
1-(8-hydroxyoctyl)-3-[4-[4-(3-methylbutoxy)phenyl]phenyl]cyclohexane-1-carbonitrile (PubChem CID 67898541) has the molecular formula C32H45NO2 and a molecular weight of 475.72 g/mol. Its IUPAC name is 1-(8-hydroxyoctyl)-3-[4-[4-(3-methylbutoxy)phenyl]phenyl]cyclohexane-1-carbonitrile.
| Compound Name | 1-(8-hydroxyoctyl)-3-[4-[4-(3-methylbutoxy)phenyl]phenyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 67898541 |
| Molecular Formula | C32H45NO2 |
| Molecular Weight | 475.72 g/mol |
| Exact Mass | 475.35 |
| IUPAC Name | 1-(8-hydroxyoctyl)-3-[4-[4-(3-methylbutoxy)phenyl]phenyl]cyclohexane-1-carbonitrile |
| SMILES | CC(C)CCOc1ccc(-c2ccc(C3CCCC(C#N)(CCCCCCCCO)C3)cc2)cc1 |
| InChI | InChI=1S/C32H45NO2/c1-26(2)19-23-35-31-17-15-28(16-18-31)27-11-13-29(14-12-27)30-10-9-21-32(24-30,25-33)20-7-5-3-4-6-8-22-34/h11-18,26,30,34H,3-10,19-24H2,1-2H3 |
| InChIKey | ZQJWLNYZXBLXRA-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.72 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|